C18H19N5O2 — CID 122159595
1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(2-phenylmethoxy-4-pyridinyl)urea (PubChem CID 122159595) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(2-phenylmethoxy-4-pyridinyl)urea.
| Compound Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(2-phenylmethoxy-4-pyridinyl)urea |
|---|---|
| PubChem CID | 122159595 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(2-phenylmethoxy-4-pyridinyl)urea |
| SMILES | Cc1n[nH]c(C)c1NC(=O)Nc1ccnc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H19N5O2/c1-12-17(13(2)23-22-12)21-18(24)20-15-8-9-19-16(10-15)25-11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,22,23)(H2,19,20,21,24) |
| InChIKey | LKDCLMTUYXLLFY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |