C17H17N5O2 — CID 75434348
1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(2-phenoxy-4-pyridinyl)urea (PubChem CID 75434348) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(2-phenoxy-4-pyridinyl)urea.
| Compound Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(2-phenoxy-4-pyridinyl)urea |
|---|---|
| PubChem CID | 75434348 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(2-phenoxy-4-pyridinyl)urea |
| SMILES | Cc1n[nH]c(C)c1NC(=O)Nc1ccnc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C17H17N5O2/c1-11-16(12(2)22-21-11)20-17(23)19-13-8-9-18-15(10-13)24-14-6-4-3-5-7-14/h3-10H,1-2H3,(H,21,22)(H2,18,19,20,23) |
| InChIKey | XOGYRWRIBIZUMC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |