C14H18N4O2 — CID 61341795
1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-[3-(1-hydroxyethyl)phenyl]urea (PubChem CID 61341795) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-[3-(1-hydroxyethyl)phenyl]urea.
| Compound Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-[3-(1-hydroxyethyl)phenyl]urea |
|---|---|
| PubChem CID | 61341795 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)-3-[3-(1-hydroxyethyl)phenyl]urea |
| SMILES | Cc1n[nH]c(C)c1NC(=O)Nc1cccc(C(C)O)c1 |
| InChI | InChI=1S/C14H18N4O2/c1-8-13(9(2)18-17-8)16-14(20)15-12-6-4-5-11(7-12)10(3)19/h4-7,10,19H,1-3H3,(H,17,18)(H2,15,16,20) |
| InChIKey | OSIBZTGYKWXXCQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |