C16H13F2N3O — CID 122159677
N-(5-cyano-2-pyridinyl)-3-(2,4-difluorophenyl)butanamide (PubChem CID 122159677) has the molecular formula C16H13F2N3O and a molecular weight of 301.30 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-3-(2,4-difluorophenyl)butanamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-3-(2,4-difluorophenyl)butanamide |
|---|---|
| PubChem CID | 122159677 |
| Molecular Formula | C16H13F2N3O |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-3-(2,4-difluorophenyl)butanamide |
| SMILES | CC(CC(=O)Nc1ccc(C#N)cn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H13F2N3O/c1-10(13-4-3-12(17)7-14(13)18)6-16(22)21-15-5-2-11(8-19)9-20-15/h2-5,7,9-10H,6H2,1H3,(H,20,21,22) |
| InChIKey | UXIAZXIDSHIDBG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |