1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride

C7H8ClFN2O — CID 122164972

IUPAC1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride
SMILESCCn1nc(C)c(C(=O)Cl)c1F
InChIInChI=1S/C7H8ClFN2O/c1-3-11-7(9)5(6(8)12)4(2)10-11/h3H2,1-2H3
InChIKeyWDKRAFFFHGMEDS-UHFFFAOYSA-N
MW190.60 g/mol
LogP1.73
Rot. Bonds2

About 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride

1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride (PubChem CID 122164972) has the molecular formula C7H8ClFN2O and a molecular weight of 190.60 g/mol. Its IUPAC name is 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride.

Molecular Properties

Compound Name1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride
PubChem CID122164972
Molecular FormulaC7H8ClFN2O
Molecular Weight190.60 g/mol
Exact Mass190.03
IUPAC Name1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride
SMILESCCn1nc(C)c(C(=O)Cl)c1F
InChIInChI=1S/C7H8ClFN2O/c1-3-11-7(9)5(6(8)12)4(2)10-11/h3H2,1-2H3
InChIKeyWDKRAFFFHGMEDS-UHFFFAOYSA-N
XLogP1.73
TPSA34.89 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.60
LogP ≤ 51.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride?
The IUPAC name of 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride (CID 122164972) is 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride.
What is the SMILES notation for 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride?
The canonical SMILES for 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride is CCn1nc(C)c(C(=O)Cl)c1F.
What is the InChIKey of 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride?
The InChIKey is WDKRAFFFHGMEDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClFN2O/c1-3-11-7(9)5(6(8)12)4(2)10-11/h3H2,1-2H3.
What are the key properties of 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride?
1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride has a molecular weight of 190.60 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-fluoro-3-methylpyrazole-4-carbonyl chloride is sourced from PubChem (CID 122164972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).