C26H30O7 — CID 122178787
(8S)-3,5-dihydroxy-8-(4-hydroxy-3-methoxyphenyl)-2-methyl-2-(4-methylpent-3-enyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromen-6-one (PubChem CID 122178787) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is (8S)-3,5-dihydroxy-8-(4-hydroxy-3-methoxyphenyl)-2-methyl-2-(4-methylpent-3-enyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromen-6-one.
| Compound Name | (8S)-3,5-dihydroxy-8-(4-hydroxy-3-methoxyphenyl)-2-methyl-2-(4-methylpent-3-enyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 122178787 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (8S)-3,5-dihydroxy-8-(4-hydroxy-3-methoxyphenyl)-2-methyl-2-(4-methylpent-3-enyl)-3,4,7,8-tetrahydropyrano[3,2-g]chromen-6-one |
| SMILES | COc1cc([C@@H]2CC(=O)c3c(cc4c(c3O)CC(O)C(C)(CCC=C(C)C)O4)O2)ccc1O |
| InChI | InChI=1S/C26H30O7/c1-14(2)6-5-9-26(3)23(29)11-16-20(33-26)13-22-24(25(16)30)18(28)12-19(32-22)15-7-8-17(27)21(10-15)31-4/h6-8,10,13,19,23,27,29-30H,5,9,11-12H2,1-4H3/t19-,23?,26?/m0/s1 |
| InChIKey | KGEXXFMIHPTSAT-YQFJPLGNSA-N |
| XLogP | 4.61 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|