C21H18F3N5O2 — CID 122180355
7-(2-morpholin-4-ylphenyl)-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-4-one (PubChem CID 122180355) has the molecular formula C21H18F3N5O2 and a molecular weight of 429.40 g/mol. Its IUPAC name is 7-(2-morpholin-4-ylphenyl)-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-4-one.
| Compound Name | 7-(2-morpholin-4-ylphenyl)-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-4-one |
|---|---|
| PubChem CID | 122180355 |
| Molecular Formula | C21H18F3N5O2 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 7-(2-morpholin-4-ylphenyl)-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-4-one |
| SMILES | O=c1c2cn[nH]c2c2ncc(-c3ccccc3N3CCOCC3)cc2n1CC(F)(F)F |
| InChI | InChI=1S/C21H18F3N5O2/c22-21(23,24)12-29-17-9-13(10-25-19(17)18-15(20(29)30)11-26-27-18)14-3-1-2-4-16(14)28-5-7-31-8-6-28/h1-4,9-11H,5-8,12H2,(H,26,27) |
| InChIKey | XJAZSPGIEYWMSB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|