C25H24N4O9 — CID 122180883
methyl 1-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]tetrazole-5-carboxylate (PubChem CID 122180883) has the molecular formula C25H24N4O9 and a molecular weight of 524.49 g/mol. Its IUPAC name is methyl 1-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]tetrazole-5-carboxylate.
| Compound Name | methyl 1-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]tetrazole-5-carboxylate |
|---|---|
| PubChem CID | 122180883 |
| Molecular Formula | C25H24N4O9 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | methyl 1-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]tetrazole-5-carboxylate |
| SMILES | COC(=O)c1nnnn1[C@@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@@H]21)OCO3 |
| InChI | InChI=1S/C25H24N4O9/c1-32-17-5-11(6-18(33-2)22(17)34-3)19-12-7-15-16(38-10-37-15)8-13(12)21(14-9-36-24(30)20(14)19)29-23(25(31)35-4)26-27-28-29/h5-8,14,19-21H,9-10H2,1-4H3/t14-,19+,20-,21+/m0/s1 |
| InChIKey | FOKVQVLAEGXQGL-MYDCNYLUSA-N |
| XLogP | 1.74 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |