C22H24IN3O2 — CID 122181774
2-[2-[4-[(4-iodophenyl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]-3H-isoindol-1-one (PubChem CID 122181774) has the molecular formula C22H24IN3O2 and a molecular weight of 489.36 g/mol. Its IUPAC name is 2-[2-[4-[(4-iodophenyl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]-3H-isoindol-1-one.
| Compound Name | 2-[2-[4-[(4-iodophenyl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 122181774 |
| Molecular Formula | C22H24IN3O2 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 2-[2-[4-[(4-iodophenyl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]-3H-isoindol-1-one |
| SMILES | O=C(CN1Cc2ccccc2C1=O)N1CCCN(Cc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C22H24IN3O2/c23-19-8-6-17(7-9-19)14-24-10-3-11-25(13-12-24)21(27)16-26-15-18-4-1-2-5-20(18)22(26)28/h1-2,4-9H,3,10-16H2 |
| InChIKey | WNHWAYNOROYFKZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|