C11H19N6O13P3 — CID 122185825
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy-(phosphonoamino)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-7-methylpurin-9-ium-6-olate (PubChem CID 122185825) has the molecular formula C11H19N6O13P3 and a molecular weight of 536.22 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy-(phosphonoamino)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-7-methylpurin-9-ium-6-olate.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy-(phosphonoamino)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-7-methylpurin-9-ium-6-olate |
|---|---|
| PubChem CID | 122185825 |
| Molecular Formula | C11H19N6O13P3 |
| Molecular Weight | 536.22 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy-(phosphonoamino)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-7-methylpurin-9-ium-6-olate |
| SMILES | Cn1c[n+]([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)NP(=O)(O)O)[C@@H](O)[C@H]2O)c2nc(N)nc([O-])c21 |
| InChI | InChI=1S/C11H19N6O13P3/c1-16-3-17(8-5(16)9(20)14-11(12)13-8)10-7(19)6(18)4(29-10)2-28-33(26,27)30-32(24,25)15-31(21,22)23/h3-4,6-7,10,18-19H,2H2,1H3,(H7-,12,13,14,15,20,21,22,23,24,25,26,27)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | WTRCWHVZWTUETP-KQYNXXCUSA-N |
| XLogP | -3.55 |
| TPSA | 295.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.22 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|