C12H18N5O8P — CID 10363021
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-7-methyl-2-(methylamino)purin-9-ium-6-olate (PubChem CID 10363021) has the molecular formula C12H18N5O8P and a molecular weight of 391.28 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-7-methyl-2-(methylamino)purin-9-ium-6-olate.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-7-methyl-2-(methylamino)purin-9-ium-6-olate |
|---|---|
| PubChem CID | 10363021 |
| Molecular Formula | C12H18N5O8P |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-7-methyl-2-(methylamino)purin-9-ium-6-olate |
| SMILES | CNc1nc([O-])c2c(n1)[n+]([C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O)cn2C |
| InChI | InChI=1S/C12H18N5O8P/c1-13-12-14-9-6(10(20)15-12)16(2)4-17(9)11-8(19)7(18)5(25-11)3-24-26(21,22)23/h4-5,7-8,11,18-19H,3H2,1-2H3,(H3-,13,14,15,20,21,22,23)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | QZJPRDAOGABNDA-IOSLPCCCSA-N |
| XLogP | -2.90 |
| TPSA | 186.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|