C12H17N3O7PS+ — CID 122592691
[(4R,5R)-3,4-dihydroxy-5-(1-methyl-7-sulfanylidene-4H-imidazo[4,5-b]pyridin-3-ium-3-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 122592691) has the molecular formula C12H17N3O7PS+ and a molecular weight of 378.32 g/mol. Its IUPAC name is [(4R,5R)-3,4-dihydroxy-5-(1-methyl-7-sulfanylidene-4H-imidazo[4,5-b]pyridin-3-ium-3-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(4R,5R)-3,4-dihydroxy-5-(1-methyl-7-sulfanylidene-4H-imidazo[4,5-b]pyridin-3-ium-3-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 122592691 |
| Molecular Formula | C12H17N3O7PS+ |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [(4R,5R)-3,4-dihydroxy-5-(1-methyl-7-sulfanylidene-4H-imidazo[4,5-b]pyridin-3-ium-3-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cn1c[n+]([C@@H]2OC(COP(=O)(O)O)C(O)[C@H]2O)c2[nH]ccc(=S)c21 |
| InChI | InChI=1S/C12H16N3O7PS/c1-14-5-15(11-8(14)7(24)2-3-13-11)12-10(17)9(16)6(22-12)4-21-23(18,19)20/h2-3,5-6,9-10,12,16-17H,4H2,1H3,(H2-,13,18,19,20,24)/p+1/t6?,9?,10-,12-/m1/s1 |
| InChIKey | UOIVALMGJZYRAF-DPEMWLNOSA-O |
| XLogP | -0.75 |
| TPSA | 141.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|