C15H25N5O8P+ — CID 137169125
[(2R,3S,4R,5R)-5-[2-(diethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 137169125) has the molecular formula C15H25N5O8P+ and a molecular weight of 434.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-(diethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[2-(diethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137169125 |
| Molecular Formula | C15H25N5O8P+ |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-(diethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCN(CC)c1nc2c(c(=O)[nH]1)n(C)c[n+]2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H24N5O8P/c1-4-19(5-2)15-16-12-9(13(23)17-15)18(3)7-20(12)14-11(22)10(21)8(28-14)6-27-29(24,25)26/h7-8,10-11,14,21-22H,4-6H2,1-3H3,(H2-,16,17,23,24,25,26)/p+1/t8-,10-,11-,14-/m1/s1 |
| InChIKey | QHGBDEKEXCSAFG-IDTAVKCVSA-O |
| XLogP | -1.88 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|