C13H21N5O10P2+2 — CID 172869047
[[(2R,3S,4R,5R)-5-[2-(dimethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxy-oxophosphanium (PubChem CID 172869047) has the molecular formula C13H21N5O10P2+2 and a molecular weight of 469.28 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[2-(dimethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxy-oxophosphanium.
| Compound Name | [[(2R,3S,4R,5R)-5-[2-(dimethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 172869047 |
| Molecular Formula | C13H21N5O10P2+2 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[2-(dimethylamino)-7-methyl-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxy-oxophosphanium |
| SMILES | CN(C)c1nc2c(c(=O)[nH]1)n(C)c[n+]2[C@@H]1O[C@H](COP(=O)(O)O[P+](=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19N5O10P2/c1-16(2)13-14-10-7(11(21)15-13)17(3)5-18(10)12-9(20)8(19)6(27-12)4-26-30(24,25)28-29(22)23/h5-6,8-9,12,19-20H,4H2,1-3H3,(H-2,14,15,21,22,23,24,25)/p+2/t6-,8-,9-,12-/m1/s1 |
| InChIKey | CBYLMJWKWFFYQA-WOUKDFQISA-P |
| XLogP | -1.98 |
| TPSA | 200.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|