C17H14N2OS — CID 122187242
(2-anilino-1,3-thiazol-5-yl)-(2-methylphenyl)methanone (PubChem CID 122187242) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is (2-anilino-1,3-thiazol-5-yl)-(2-methylphenyl)methanone.
| Compound Name | (2-anilino-1,3-thiazol-5-yl)-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 122187242 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2-anilino-1,3-thiazol-5-yl)-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)c1cnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C17H14N2OS/c1-12-7-5-6-10-14(12)16(20)15-11-18-17(21-15)19-13-8-3-2-4-9-13/h2-11H,1H3,(H,18,19) |
| InChIKey | ZFFONJXVKOIMJJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |