C27H27BrFN3O2 — CID 122191006
4-bromo-N-[(1R,2R)-6-[1-[2-(4-fluorophenyl)ethyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 122191006) has the molecular formula C27H27BrFN3O2 and a molecular weight of 524.43 g/mol. Its IUPAC name is 4-bromo-N-[(1R,2R)-6-[1-[2-(4-fluorophenyl)ethyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 4-bromo-N-[(1R,2R)-6-[1-[2-(4-fluorophenyl)ethyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 122191006 |
| Molecular Formula | C27H27BrFN3O2 |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 4-bromo-N-[(1R,2R)-6-[1-[2-(4-fluorophenyl)ethyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | C/C(=N\c1ccc2c(c1)[C@@H](NC(=O)c1ccc(Br)cc1)[C@H](O)C2)N(C)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C27H27BrFN3O2/c1-17(32(2)14-13-18-3-10-22(29)11-4-18)30-23-12-7-20-15-25(33)26(24(20)16-23)31-27(34)19-5-8-21(28)9-6-19/h3-12,16,25-26,33H,13-15H2,1-2H3,(H,31,34)/b30-17+/t25-,26-/m1/s1 |
| InChIKey | AMCZEBWTXNDLAJ-MKFQNBQCSA-N |
| XLogP | 5.20 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|