C32H28F3N3O2 — CID 59654588
N-[(1R,2R)-6-[1-[(3,4-difluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide (PubChem CID 59654588) has the molecular formula C32H28F3N3O2 and a molecular weight of 543.59 g/mol. Its IUPAC name is N-[(1R,2R)-6-[1-[(3,4-difluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide.
| Compound Name | N-[(1R,2R)-6-[1-[(3,4-difluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide |
|---|---|
| PubChem CID | 59654588 |
| Molecular Formula | C32H28F3N3O2 |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | N-[(1R,2R)-6-[1-[(3,4-difluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-phenylbenzamide |
| SMILES | C/C(=N\c1ccc2c(c1)[C@@H](NC(=O)c1ccc(-c3ccccc3)cc1F)[C@H](O)C2)N(C)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C32H28F3N3O2/c1-19(38(2)18-20-8-13-27(33)29(35)14-20)36-24-11-9-23-16-30(39)31(26(23)17-24)37-32(40)25-12-10-22(15-28(25)34)21-6-4-3-5-7-21/h3-15,17,30-31,39H,16,18H2,1-2H3,(H,37,40)/b36-19+/t30-,31-/m1/s1 |
| InChIKey | FHYUPDOQFRSJJM-LGPLDCKYSA-N |
| XLogP | 6.34 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|