C28H30F2N2O3 — CID 91088733
N-[(1R,2R)-6-[(3-ethoxypropylamino)methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-(2-fluorophenyl)benzamide (PubChem CID 91088733) has the molecular formula C28H30F2N2O3 and a molecular weight of 480.56 g/mol. Its IUPAC name is N-[(1R,2R)-6-[(3-ethoxypropylamino)methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-(2-fluorophenyl)benzamide.
| Compound Name | N-[(1R,2R)-6-[(3-ethoxypropylamino)methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-(2-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 91088733 |
| Molecular Formula | C28H30F2N2O3 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | N-[(1R,2R)-6-[(3-ethoxypropylamino)methyl]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-2-fluoro-4-(2-fluorophenyl)benzamide |
| SMILES | CCOCCCNCc1ccc2c(c1)[C@@H](NC(=O)c1ccc(-c3ccccc3F)cc1F)[C@H](O)C2 |
| InChI | InChI=1S/C28H30F2N2O3/c1-2-35-13-5-12-31-17-18-8-9-20-16-26(33)27(23(20)14-18)32-28(34)22-11-10-19(15-25(22)30)21-6-3-4-7-24(21)29/h3-4,6-11,14-15,26-27,31,33H,2,5,12-13,16-17H2,1H3,(H,32,34)/t26-,27-/m1/s1 |
| InChIKey | SQRAXIZTPIXVOZ-KAYWLYCHSA-N |
| XLogP | 4.54 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|