C8H10F2N2O — CID 122192580
2,2-difluoro-1-(1-propan-2-ylpyrazol-4-yl)ethanone (PubChem CID 122192580) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is 2,2-difluoro-1-(1-propan-2-ylpyrazol-4-yl)ethanone.
| Compound Name | 2,2-difluoro-1-(1-propan-2-ylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 122192580 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2,2-difluoro-1-(1-propan-2-ylpyrazol-4-yl)ethanone |
| SMILES | CC(C)n1cc(C(=O)C(F)F)cn1 |
| InChI | InChI=1S/C8H10F2N2O/c1-5(2)12-4-6(3-11-12)7(13)8(9)10/h3-5,8H,1-2H3 |
| InChIKey | FFMMFXZONQYESO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |