C10H12F2N2O — CID 122192584
1-(1-cyclopentylpyrazol-4-yl)-2,2-difluoroethanone (PubChem CID 122192584) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrazol-4-yl)-2,2-difluoroethanone.
| Compound Name | 1-(1-cyclopentylpyrazol-4-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 122192584 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-(1-cyclopentylpyrazol-4-yl)-2,2-difluoroethanone |
| SMILES | O=C(c1cnn(C2CCCC2)c1)C(F)F |
| InChI | InChI=1S/C10H12F2N2O/c11-10(12)9(15)7-5-13-14(6-7)8-3-1-2-4-8/h5-6,8,10H,1-4H2 |
| InChIKey | LCJHAMFHXGMYLX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |