C10H14F2N2O — CID 122192583
2,2-difluoro-1-(1-pentan-3-ylpyrazol-4-yl)ethanone (PubChem CID 122192583) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is 2,2-difluoro-1-(1-pentan-3-ylpyrazol-4-yl)ethanone.
| Compound Name | 2,2-difluoro-1-(1-pentan-3-ylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 122192583 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2,2-difluoro-1-(1-pentan-3-ylpyrazol-4-yl)ethanone |
| SMILES | CCC(CC)n1cc(C(=O)C(F)F)cn1 |
| InChI | InChI=1S/C10H14F2N2O/c1-3-8(4-2)14-6-7(5-13-14)9(15)10(11)12/h5-6,8,10H,3-4H2,1-2H3 |
| InChIKey | OMWCMVDBFIANLH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |