C9H12F2N2O — CID 122192581
1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone (PubChem CID 122192581) has the molecular formula C9H12F2N2O and a molecular weight of 202.20 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone.
| Compound Name | 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 122192581 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone |
| SMILES | CCC(C)n1cc(C(=O)C(F)F)cn1 |
| InChI | InChI=1S/C9H12F2N2O/c1-3-6(2)13-5-7(4-12-13)8(14)9(10)11/h4-6,9H,3H2,1-2H3 |
| InChIKey | KIPNKBSUTXPLGR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |