About 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone
1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone (PubChem CID 122192581) has the molecular formula C9H12F2N2O
and a molecular weight of 202.20 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone |
| PubChem CID | 122192581 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone |
| SMILES | CCC(C)n1cc(C(=O)C(F)F)cn1 |
| InChI | InChI=1S/C9H12F2N2O/c1-3-6(2)13-5-7(4-12-13)8(14)9(10)11/h4-6,9H,3H2,1-2H3 |
| InChIKey | KIPNKBSUTXPLGR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone?
The IUPAC name of 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone (CID 122192581) is 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone?
The canonical SMILES for 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone is CCC(C)n1cc(C(=O)C(F)F)cn1.
What is the InChIKey of 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone?
The InChIKey is KIPNKBSUTXPLGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O/c1-3-6(2)13-5-7(4-12-13)8(14)9(10)11/h4-6,9H,3H2,1-2H3.
What are the key properties of 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone?
1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone has a molecular weight of 202.20 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-butan-2-ylpyrazol-4-yl)-2,2-difluoroethanone is sourced from PubChem (CID 122192581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).