C23H27N7O11S — CID 122194234
4-O-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 1-O-[[(2R,3S,4R,5R)-5-(4-carbamoyl-1,3-thiazol-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl] butanedioate (PubChem CID 122194234) has the molecular formula C23H27N7O11S and a molecular weight of 609.57 g/mol. Its IUPAC name is 4-O-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 1-O-[[(2R,3S,4R,5R)-5-(4-carbamoyl-1,3-thiazol-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl] butanedioate.
| Compound Name | 4-O-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 1-O-[[(2R,3S,4R,5R)-5-(4-carbamoyl-1,3-thiazol-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl] butanedioate |
|---|---|
| PubChem CID | 122194234 |
| Molecular Formula | C23H27N7O11S |
| Molecular Weight | 609.57 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | 4-O-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 1-O-[[(2R,3S,4R,5R)-5-(4-carbamoyl-1,3-thiazol-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl] butanedioate |
| SMILES | NC(=O)c1csc([C@@H]2O[C@H](COC(=O)CCC(=O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C23H27N7O11S/c24-19-13-21(27-6-26-19)30(7-28-13)23-17(36)15(34)10(41-23)4-39-12(32)2-1-11(31)38-3-9-14(33)16(35)18(40-9)22-29-8(5-42-22)20(25)37/h5-7,9-10,14-18,23,33-36H,1-4H2,(H2,25,37)(H2,24,26,27)/t9-,10-,14-,15-,16-,17-,18-,23-/m1/s1 |
| InChIKey | NEWKLKBAIQIKRA-KFGMBTRNSA-N |
| XLogP | -2.69 |
| TPSA | 277.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.57 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |