C26H33NO10S — CID 122197299
(7S)-1,2,3-trimethoxy-10-methylsulfanyl-7-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyamino]-6,7-dihydro-5H-benzo[a]heptalen-9-one (PubChem CID 122197299) has the molecular formula C26H33NO10S and a molecular weight of 551.61 g/mol. Its IUPAC name is (7S)-1,2,3-trimethoxy-10-methylsulfanyl-7-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyamino]-6,7-dihydro-5H-benzo[a]heptalen-9-one.
| Compound Name | (7S)-1,2,3-trimethoxy-10-methylsulfanyl-7-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyamino]-6,7-dihydro-5H-benzo[a]heptalen-9-one |
|---|---|
| PubChem CID | 122197299 |
| Molecular Formula | C26H33NO10S |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | (7S)-1,2,3-trimethoxy-10-methylsulfanyl-7-[[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyamino]-6,7-dihydro-5H-benzo[a]heptalen-9-one |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NO[C@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1O)CC2 |
| InChI | InChI=1S/C26H33NO10S/c1-33-17-9-12-5-7-15(27-37-26-23(32)22(31)21(30)18(11-28)36-26)14-10-16(29)19(38-4)8-6-13(14)20(12)25(35-3)24(17)34-2/h6,8-10,15,18,21-23,26-28,30-32H,5,7,11H2,1-4H3/t15-,18-,21-,22+,23-,26+/m0/s1 |
| InChIKey | FVAFSINICVPVEF-FGZBHIRESA-N |
| XLogP | 0.77 |
| TPSA | 156.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|