C34H41NO13S — CID 97298443
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[[(7R)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]amino]oxan-2-yl]methyl acetate (PubChem CID 97298443) has the molecular formula C34H41NO13S and a molecular weight of 703.76 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[[(7R)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[[(7R)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 97298443 |
| Molecular Formula | C34H41NO13S |
| Molecular Weight | 703.76 g/mol |
| Exact Mass | 703.23 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[[(7R)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]amino]oxan-2-yl]methyl acetate |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1[C@H](N[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O)CC2 |
| InChI | InChI=1S/C34H41NO13S/c1-16(36)44-15-26-30(45-17(2)37)32(46-18(3)38)33(47-19(4)39)34(48-26)35-23-11-9-20-13-25(41-5)29(42-6)31(43-7)28(20)21-10-12-27(49-8)24(40)14-22(21)23/h10,12-14,23,26,30,32-35H,9,11,15H2,1-8H3/t23-,26-,30-,32+,33+,34-/m1/s1 |
| InChIKey | DINYYSXLAGRWQI-MTGHEJBRSA-N |
| XLogP | 3.12 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|