C8H2Br2FNO3 — CID 122200694
6,8-dibromo-5-fluoro-1H-3,1-benzoxazine-2,4-dione (PubChem CID 122200694) has the molecular formula C8H2Br2FNO3 and a molecular weight of 338.91 g/mol. Its IUPAC name is 6,8-dibromo-5-fluoro-1H-3,1-benzoxazine-2,4-dione.
| Compound Name | 6,8-dibromo-5-fluoro-1H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 122200694 |
| Molecular Formula | C8H2Br2FNO3 |
| Molecular Weight | 338.91 g/mol |
| Exact Mass | 336.84 |
| IUPAC Name | 6,8-dibromo-5-fluoro-1H-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1[nH]c2c(Br)cc(Br)c(F)c2c(=O)o1 |
| InChI | InChI=1S/C8H2Br2FNO3/c9-2-1-3(10)6-4(5(2)11)7(13)15-8(14)12-6/h1H,(H,12,14) |
| InChIKey | SYRAURCJTOREQU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.91 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|