C20H17NO6S — CID 122201859
cis-dimethyl (2S,3R)-2-(benzenesulfonyl)-2-cyano-3-phenylcyclopropane-1,1-dicarboxylate (PubChem CID 122201859) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is cis-dimethyl (2S,3R)-2-(benzenesulfonyl)-2-cyano-3-phenylcyclopropane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (2S,3R)-2-(benzenesulfonyl)-2-cyano-3-phenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 122201859 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | cis-dimethyl (2S,3R)-2-(benzenesulfonyl)-2-cyano-3-phenylcyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](c2ccccc2)[C@]1(C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17NO6S/c1-26-17(22)20(18(23)27-2)16(14-9-5-3-6-10-14)19(20,13-21)28(24,25)15-11-7-4-8-12-15/h3-12,16H,1-2H3/t16-,19-/m0/s1 |
| InChIKey | XKNJDGXKIJSUNZ-LPHOPBHVSA-N |
| XLogP | 1.85 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|