C18H25NO4 — CID 122207750
tert-butyl 5-oxo-2-[1-(3-oxocyclohexen-1-yl)propan-2-yl]-2H-pyrrole-1-carboxylate (PubChem CID 122207750) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is tert-butyl 5-oxo-2-[1-(3-oxocyclohexen-1-yl)propan-2-yl]-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-oxo-2-[1-(3-oxocyclohexen-1-yl)propan-2-yl]-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 122207750 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | tert-butyl 5-oxo-2-[1-(3-oxocyclohexen-1-yl)propan-2-yl]-2H-pyrrole-1-carboxylate |
| SMILES | CC(CC1=CC(=O)CCC1)C1C=CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO4/c1-12(10-13-6-5-7-14(20)11-13)15-8-9-16(21)19(15)17(22)23-18(2,3)4/h8-9,11-12,15H,5-7,10H2,1-4H3 |
| InChIKey | JVEUONDXEBOXSU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |