C29H29NO4 — CID 122208056
5,7-dimethoxy-8-[(6S,10R)-8-methyl-10-(2-methylprop-1-enyl)-5,6,9,10-tetrahydrocyclohepta[b]indol-6-yl]chromen-2-one (PubChem CID 122208056) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is 5,7-dimethoxy-8-[(6S,10R)-8-methyl-10-(2-methylprop-1-enyl)-5,6,9,10-tetrahydrocyclohepta[b]indol-6-yl]chromen-2-one.
| Compound Name | 5,7-dimethoxy-8-[(6S,10R)-8-methyl-10-(2-methylprop-1-enyl)-5,6,9,10-tetrahydrocyclohepta[b]indol-6-yl]chromen-2-one |
|---|---|
| PubChem CID | 122208056 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 5,7-dimethoxy-8-[(6S,10R)-8-methyl-10-(2-methylprop-1-enyl)-5,6,9,10-tetrahydrocyclohepta[b]indol-6-yl]chromen-2-one |
| SMILES | COc1cc(OC)c2ccc(=O)oc2c1[C@@H]1C=C(C)C[C@H](C=C(C)C)c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C29H29NO4/c1-16(2)12-18-13-17(3)14-21(28-26(18)19-8-6-7-9-22(19)30-28)27-24(33-5)15-23(32-4)20-10-11-25(31)34-29(20)27/h6-12,14-15,18,21,30H,13H2,1-5H3/t18-,21-/m0/s1 |
| InChIKey | AMVDJIOHTCIXCX-RXVVDRJESA-N |
| XLogP | 6.82 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|