C38H50N2O12 — CID 122208567
[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3-ethynyl-5-[[3-ethynyl-5-[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]oxycarbonylphenyl]diazenyl]benzoate (PubChem CID 122208567) has the molecular formula C38H50N2O12 and a molecular weight of 726.82 g/mol. Its IUPAC name is [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3-ethynyl-5-[[3-ethynyl-5-[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]oxycarbonylphenyl]diazenyl]benzoate.
| Compound Name | [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3-ethynyl-5-[[3-ethynyl-5-[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]oxycarbonylphenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 122208567 |
| Molecular Formula | C38H50N2O12 |
| Molecular Weight | 726.82 g/mol |
| Exact Mass | 726.34 |
| IUPAC Name | [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3-ethynyl-5-[[3-ethynyl-5-[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]oxycarbonylphenyl]diazenyl]benzoate |
| SMILES | C#Cc1cc(/N=N/c2cc(C#C)cc(C(=O)O[C@@H](C)COCCOCCOCCOC)c2)cc(C(=O)O[C@@H](C)COCCOCCOCCOC)c1 |
| InChI | InChI=1S/C38H50N2O12/c1-7-31-21-33(37(41)51-29(3)27-49-19-17-47-15-13-45-11-9-43-5)25-35(23-31)39-40-36-24-32(8-2)22-34(26-36)38(42)52-30(4)28-50-20-18-48-16-14-46-12-10-44-6/h1-2,21-26,29-30H,9-20,27-28H2,3-6H3/b40-39+/t29-,30-/m0/s1 |
| InChIKey | IBQWUHQHWQPTQQ-YIUSLUKASA-N |
| XLogP | 4.55 |
| TPSA | 151.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|