C34H48Br2N2O12 — CID 122208566
[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3-bromo-5-[[3-bromo-5-[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]oxycarbonylphenyl]diazenyl]benzoate (PubChem CID 122208566) has the molecular formula C34H48Br2N2O12 and a molecular weight of 836.57 g/mol. Its IUPAC name is [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3-bromo-5-[[3-bromo-5-[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]oxycarbonylphenyl]diazenyl]benzoate.
| Compound Name | [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3-bromo-5-[[3-bromo-5-[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]oxycarbonylphenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 122208566 |
| Molecular Formula | C34H48Br2N2O12 |
| Molecular Weight | 836.57 g/mol |
| Exact Mass | 834.16 |
| IUPAC Name | [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3-bromo-5-[[3-bromo-5-[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]oxycarbonylphenyl]diazenyl]benzoate |
| SMILES | COCCOCCOCCOC[C@H](C)OC(=O)c1cc(Br)cc(/N=N/c2cc(Br)cc(C(=O)O[C@@H](C)COCCOCCOCCOC)c2)c1 |
| InChI | InChI=1S/C34H48Br2N2O12/c1-25(23-47-15-13-45-11-9-43-7-5-41-3)49-33(39)27-17-29(35)21-31(19-27)37-38-32-20-28(18-30(36)22-32)34(40)50-26(2)24-48-16-14-46-12-10-44-8-6-42-4/h17-22,25-26H,5-16,23-24H2,1-4H3/b38-37+/t25-,26-/m0/s1 |
| InChIKey | IIMGBQZMJNHJQE-UVWAJLQYSA-N |
| XLogP | 6.11 |
| TPSA | 151.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|