About [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate
[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate (PubChem CID 132965727) has the molecular formula C21H30O6
and a molecular weight of 378.47 g/mol. Its IUPAC name is [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate.
Molecular Properties
| Compound Name | [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate |
| PubChem CID | 132965727 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate |
| SMILES | C=Cc1cc(C=C)cc(C(=O)O[C@@H](C)COCCOCCOCCOC)c1 |
| InChI | InChI=1S/C21H30O6/c1-5-18-13-19(6-2)15-20(14-18)21(22)27-17(3)16-26-12-11-25-10-9-24-8-7-23-4/h5-6,13-15,17H,1-2,7-12,16H2,3-4H3/t17-/m0/s1 |
| InChIKey | NETBCORMALRPKY-KRWDZBQOSA-N |
| XLogP | 3.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate?
The IUPAC name of [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate (CID 132965727) is [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate.
What is the SMILES notation for [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate?
The canonical SMILES for [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate is C=Cc1cc(C=C)cc(C(=O)O[C@@H](C)COCCOCCOCCOC)c1.
What is the InChIKey of [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate?
The InChIKey is NETBCORMALRPKY-KRWDZBQOSA-N. The full InChI is InChI=1S/C21H30O6/c1-5-18-13-19(6-2)15-20(14-18)21(22)27-17(3)16-26-12-11-25-10-9-24-8-7-23-4/h5-6,13-15,17H,1-2,7-12,16H2,3-4H3/t17-/m0/s1.
What are the key properties of [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate?
[(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate has a molecular weight of 378.47 g/mol, XLogP of 3.21, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl] 3,5-bis(ethenyl)benzoate is sourced from PubChem (CID 132965727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).