C15H21N3O3S — CID 122211529
3-[2-imino-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonic acid (PubChem CID 122211529) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 3-[2-imino-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-imino-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 122211529 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-[2-imino-3-(2,4,6-trimethylphenyl)imidazol-1-yl]propane-1-sulfonic acid |
| SMILES | [H]/N=c1\n(CCCS(=O)(=O)O)ccn1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H21N3O3S/c1-11-9-12(2)14(13(3)10-11)18-7-6-17(15(18)16)5-4-8-22(19,20)21/h6-7,9-10,16H,4-5,8H2,1-3H3,(H,19,20,21)/b16-15+ |
| InChIKey | QQLQREGWODIMNI-FOCLMDBBSA-N |
| XLogP | 1.96 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|