C33H32O2S2 — CID 122212818
ethyl 5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-3-methylidene-1-phenylindene-2-carboxylate (PubChem CID 122212818) has the molecular formula C33H32O2S2 and a molecular weight of 524.75 g/mol. Its IUPAC name is ethyl 5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-3-methylidene-1-phenylindene-2-carboxylate.
| Compound Name | ethyl 5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-3-methylidene-1-phenylindene-2-carboxylate |
|---|---|
| PubChem CID | 122212818 |
| Molecular Formula | C33H32O2S2 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | ethyl 5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-3-methylidene-1-phenylindene-2-carboxylate |
| SMILES | C=C1C(C(=O)OCC)=C(c2ccccc2)c2ccc(-c3ccc(-c4ccc(CCCCCC)s4)s3)cc21 |
| InChI | InChI=1S/C33H32O2S2/c1-4-6-7-11-14-25-16-18-29(36-25)30-20-19-28(37-30)24-15-17-26-27(21-24)22(3)31(33(34)35-5-2)32(26)23-12-9-8-10-13-23/h8-10,12-13,15-21H,3-7,11,14H2,1-2H3 |
| InChIKey | SNMHGDBTPLQFEJ-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|