C17H12N4O2 — CID 122214067
1-(1,3-benzodioxol-5-ylmethyl)-5-phenyltriazole-4-carbonitrile (PubChem CID 122214067) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-5-phenyltriazole-4-carbonitrile.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-5-phenyltriazole-4-carbonitrile |
|---|---|
| PubChem CID | 122214067 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-5-phenyltriazole-4-carbonitrile |
| SMILES | N#Cc1nnn(Cc2ccc3c(c2)OCO3)c1-c1ccccc1 |
| InChI | InChI=1S/C17H12N4O2/c18-9-14-17(13-4-2-1-3-5-13)21(20-19-14)10-12-6-7-15-16(8-12)23-11-22-15/h1-8H,10-11H2 |
| InChIKey | XXZIJVVGGQXQSO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |