C25H22N2O2 — CID 164518980
1-(1,3-benzodioxol-5-ylmethyl)-4-ethyl-3,5-diphenylpyrazole (PubChem CID 164518980) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-ethyl-3,5-diphenylpyrazole.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-ethyl-3,5-diphenylpyrazole |
|---|---|
| PubChem CID | 164518980 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-ethyl-3,5-diphenylpyrazole |
| SMILES | CCc1c(-c2ccccc2)nn(Cc2ccc3c(c2)OCO3)c1-c1ccccc1 |
| InChI | InChI=1S/C25H22N2O2/c1-2-21-24(19-9-5-3-6-10-19)26-27(25(21)20-11-7-4-8-12-20)16-18-13-14-22-23(15-18)29-17-28-22/h3-15H,2,16-17H2,1H3 |
| InChIKey | UEMAMXLKYSQEDA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |