C23H24N2O4S2 — CID 122214160
N-[(1-benzylsulfonyl-2,3-dihydroindol-2-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 122214160) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[(1-benzylsulfonyl-2,3-dihydroindol-2-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1-benzylsulfonyl-2,3-dihydroindol-2-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122214160 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-[(1-benzylsulfonyl-2,3-dihydroindol-2-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2Cc3ccccc3N2S(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O4S2/c1-18-11-13-22(14-12-18)31(28,29)24-16-21-15-20-9-5-6-10-23(20)25(21)30(26,27)17-19-7-3-2-4-8-19/h2-14,21,24H,15-17H2,1H3 |
| InChIKey | IARTUNFRHOAMRL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |