C26H29NO3Si — CID 122214437
benzyl N-[(E)-3-[dimethyl(phenyl)silyl]-1-(2-methoxyphenyl)prop-2-enyl]carbamate (PubChem CID 122214437) has the molecular formula C26H29NO3Si and a molecular weight of 431.61 g/mol. Its IUPAC name is benzyl N-[(E)-3-[dimethyl(phenyl)silyl]-1-(2-methoxyphenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[(E)-3-[dimethyl(phenyl)silyl]-1-(2-methoxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 122214437 |
| Molecular Formula | C26H29NO3Si |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | benzyl N-[(E)-3-[dimethyl(phenyl)silyl]-1-(2-methoxyphenyl)prop-2-enyl]carbamate |
| SMILES | COc1ccccc1C(/C=C/[Si](C)(C)c1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H29NO3Si/c1-29-25-17-11-10-16-23(25)24(18-19-31(2,3)22-14-8-5-9-15-22)27-26(28)30-20-21-12-6-4-7-13-21/h4-19,24H,20H2,1-3H3,(H,27,28)/b19-18+ |
| InChIKey | ATVQFQHYGPTCJP-VHEBQXMUSA-N |
| XLogP | 5.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|