C26H27NO4Si — CID 122214445
benzyl N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[dimethyl(phenyl)silyl]prop-2-enyl]carbamate (PubChem CID 122214445) has the molecular formula C26H27NO4Si and a molecular weight of 445.59 g/mol. Its IUPAC name is benzyl N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[dimethyl(phenyl)silyl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[dimethyl(phenyl)silyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 122214445 |
| Molecular Formula | C26H27NO4Si |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | benzyl N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[dimethyl(phenyl)silyl]prop-2-enyl]carbamate |
| SMILES | C[Si](C)(/C=C/C(NC(=O)OCc1ccccc1)c1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C26H27NO4Si/c1-32(2,22-11-7-4-8-12-22)16-15-23(21-13-14-24-25(17-21)31-19-30-24)27-26(28)29-18-20-9-5-3-6-10-20/h3-17,23H,18-19H2,1-2H3,(H,27,28)/b16-15+ |
| InChIKey | CCUVKRLXQHWUJH-FOCLMDBBSA-N |
| XLogP | 5.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|