C24H19NO6 — CID 44557732
benzyl 2-(1,3-benzodioxole-5-carbonylamino)-3-oxo-3-phenylpropanoate (PubChem CID 44557732) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is benzyl 2-(1,3-benzodioxole-5-carbonylamino)-3-oxo-3-phenylpropanoate.
| Compound Name | benzyl 2-(1,3-benzodioxole-5-carbonylamino)-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 44557732 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | benzyl 2-(1,3-benzodioxole-5-carbonylamino)-3-oxo-3-phenylpropanoate |
| SMILES | O=C(NC(C(=O)OCc1ccccc1)C(=O)c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H19NO6/c26-22(17-9-5-2-6-10-17)21(24(28)29-14-16-7-3-1-4-8-16)25-23(27)18-11-12-19-20(13-18)31-15-30-19/h1-13,21H,14-15H2,(H,25,27) |
| InChIKey | FJNFOBFAGOJDJY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|