C53H52N2S3 — CID 122215764
7-[4-[2-[4-[[10-(4-tert-butyl-2,6-dimethylphenyl)anthracen-9-yl]-diazomethyl]-3,5-dimethylphenyl]ethynyl]phenyl]adamantane-1,3,5-trithiol (PubChem CID 122215764) has the molecular formula C53H52N2S3 and a molecular weight of 813.21 g/mol. Its IUPAC name is 7-[4-[2-[4-[[10-(4-tert-butyl-2,6-dimethylphenyl)anthracen-9-yl]-diazomethyl]-3,5-dimethylphenyl]ethynyl]phenyl]adamantane-1,3,5-trithiol.
| Compound Name | 7-[4-[2-[4-[[10-(4-tert-butyl-2,6-dimethylphenyl)anthracen-9-yl]-diazomethyl]-3,5-dimethylphenyl]ethynyl]phenyl]adamantane-1,3,5-trithiol |
|---|---|
| PubChem CID | 122215764 |
| Molecular Formula | C53H52N2S3 |
| Molecular Weight | 813.21 g/mol |
| Exact Mass | 812.33 |
| IUPAC Name | 7-[4-[2-[4-[[10-(4-tert-butyl-2,6-dimethylphenyl)anthracen-9-yl]-diazomethyl]-3,5-dimethylphenyl]ethynyl]phenyl]adamantane-1,3,5-trithiol |
| SMILES | Cc1cc(C#Cc2ccc(C34CC5(S)CC(S)(CC(S)(C5)C3)C4)cc2)cc(C)c1C(=[N+]=[N-])c1c2ccccc2c(-c2c(C)cc(C(C)(C)C)cc2C)c2ccccc12 |
| InChI | InChI=1S/C53H52N2S3/c1-32-22-37(17-16-36-18-20-38(21-19-36)50-26-51(56)29-52(57,27-50)31-53(58,28-50)30-51)23-33(2)45(32)48(55-54)47-42-14-10-8-12-40(42)46(41-13-9-11-15-43(41)47)44-34(3)24-39(25-35(44)4)49(5,6)7/h8-15,18-25,56-58H,26-31H2,1-7H3 |
| InChIKey | XMNRZAVRXKWPPG-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 36.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.21 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|