C39H44N2S3 — CID 102345224
7-[4-[2-[4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-3,5-dimethylphenyl]ethynyl]phenyl]adamantane-1,3,5-trithiol (PubChem CID 102345224) has the molecular formula C39H44N2S3 and a molecular weight of 637.00 g/mol. Its IUPAC name is 7-[4-[2-[4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-3,5-dimethylphenyl]ethynyl]phenyl]adamantane-1,3,5-trithiol.
| Compound Name | 7-[4-[2-[4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-3,5-dimethylphenyl]ethynyl]phenyl]adamantane-1,3,5-trithiol |
|---|---|
| PubChem CID | 102345224 |
| Molecular Formula | C39H44N2S3 |
| Molecular Weight | 637.00 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | 7-[4-[2-[4-[(4-tert-butyl-2,6-dimethylphenyl)-diazomethyl]-3,5-dimethylphenyl]ethynyl]phenyl]adamantane-1,3,5-trithiol |
| SMILES | Cc1cc(C#Cc2ccc(C34CC5(S)CC(S)(CC(S)(C5)C3)C4)cc2)cc(C)c1C(=[N+]=[N-])c1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C39H44N2S3/c1-24-14-29(15-25(2)32(24)34(41-40)33-26(3)16-31(17-27(33)4)35(5,6)7)9-8-28-10-12-30(13-11-28)36-18-37(42)21-38(43,19-36)23-39(44,20-36)22-37/h10-17,42-44H,18-23H2,1-7H3 |
| InChIKey | BYLHJGLDEFVREG-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 36.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.00 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|