C30H30N2O8 — CID 122218204
tetramethyl 5,6-bis[(2,6-dimethylphenyl)imino]cyclohexa-1,3-diene-1,2,3,4-tetracarboxylate (PubChem CID 122218204) has the molecular formula C30H30N2O8 and a molecular weight of 546.58 g/mol. Its IUPAC name is tetramethyl 5,6-bis[(2,6-dimethylphenyl)imino]cyclohexa-1,3-diene-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl 5,6-bis[(2,6-dimethylphenyl)imino]cyclohexa-1,3-diene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 122218204 |
| Molecular Formula | C30H30N2O8 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | tetramethyl 5,6-bis[(2,6-dimethylphenyl)imino]cyclohexa-1,3-diene-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)/C(=N/c2c(C)cccc2C)C1=Nc1c(C)cccc1C |
| InChI | InChI=1S/C30H30N2O8/c1-15-11-9-12-16(2)23(15)31-25-21(29(35)39-7)19(27(33)37-5)20(28(34)38-6)22(30(36)40-8)26(25)32-24-17(3)13-10-14-18(24)4/h9-14H,1-8H3/b31-25-,32-26? |
| InChIKey | ZXACEVPFQULQGN-LIPMBRRKSA-N |
| XLogP | 4.06 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|