C19H21NO7 — CID 135002941
dimethyl 2-acetyloxy-5-(2,6-dimethylphenyl)imino-2-methylfuran-3,4-dicarboxylate (PubChem CID 135002941) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is dimethyl 2-acetyloxy-5-(2,6-dimethylphenyl)imino-2-methylfuran-3,4-dicarboxylate.
| Compound Name | dimethyl 2-acetyloxy-5-(2,6-dimethylphenyl)imino-2-methylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 135002941 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | dimethyl 2-acetyloxy-5-(2,6-dimethylphenyl)imino-2-methylfuran-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C)(OC(C)=O)O/C1=N\c1c(C)cccc1C |
| InChI | InChI=1S/C19H21NO7/c1-10-8-7-9-11(2)15(10)20-16-13(17(22)24-5)14(18(23)25-6)19(4,27-16)26-12(3)21/h7-9H,1-6H3/b20-16- |
| InChIKey | BQVDEHQGVBKSON-SILNSSARSA-N |
| XLogP | 2.29 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|