C21H21NO7 — CID 11292483
dimethyl 5'-cyclohexylimino-3-oxospiro[2-benzofuran-1,2'-furan]-3',4'-dicarboxylate (PubChem CID 11292483) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is dimethyl 5'-cyclohexylimino-3-oxospiro[2-benzofuran-1,2'-furan]-3',4'-dicarboxylate.
| Compound Name | dimethyl 5'-cyclohexylimino-3-oxospiro[2-benzofuran-1,2'-furan]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 11292483 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | dimethyl 5'-cyclohexylimino-3-oxospiro[2-benzofuran-1,2'-furan]-3',4'-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(OC(=O)c3ccccc32)O/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C21H21NO7/c1-26-19(24)15-16(20(25)27-2)21(14-11-7-6-10-13(14)18(23)29-21)28-17(15)22-12-8-4-3-5-9-12/h6-7,10-12H,3-5,8-9H2,1-2H3/b22-17- |
| InChIKey | QDRAWJBKBXEBDR-XLNRJJMWSA-N |
| XLogP | 2.41 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|