C19H20O5 — CID 163051660
dimethyl (1S,10S)-1,10-dimethyl-12-oxatetracyclo[7.5.0.02,7.011,13]tetradeca-2,4,6,8-tetraene-8,10-dicarboxylate (PubChem CID 163051660) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is dimethyl (1S,10S)-1,10-dimethyl-12-oxatetracyclo[7.5.0.02,7.011,13]tetradeca-2,4,6,8-tetraene-8,10-dicarboxylate.
| Compound Name | dimethyl (1S,10S)-1,10-dimethyl-12-oxatetracyclo[7.5.0.02,7.011,13]tetradeca-2,4,6,8-tetraene-8,10-dicarboxylate |
|---|---|
| PubChem CID | 163051660 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | dimethyl (1S,10S)-1,10-dimethyl-12-oxatetracyclo[7.5.0.02,7.011,13]tetradeca-2,4,6,8-tetraene-8,10-dicarboxylate |
| SMILES | COC(=O)C1=C2[C@](C)(C(=O)OC)C3OC3C[C@@]2(C)c2ccccc21 |
| InChI | InChI=1S/C19H20O5/c1-18-9-12-15(24-12)19(2,17(21)23-4)14(18)13(16(20)22-3)10-7-5-6-8-11(10)18/h5-8,12,15H,9H2,1-4H3/t12?,15?,18-,19-/m0/s1 |
| InChIKey | CCCHYPOECSYCKC-JGUAIJRYSA-N |
| XLogP | 2.23 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|