C27H19ClN2O3 — CID 122221340
3-(4-chlorophenyl)-1-phenyl-2-(pyridine-2-carbonyl)-4-pyridin-2-ylbutane-1,4-dione (PubChem CID 122221340) has the molecular formula C27H19ClN2O3 and a molecular weight of 454.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-phenyl-2-(pyridine-2-carbonyl)-4-pyridin-2-ylbutane-1,4-dione.
| Compound Name | 3-(4-chlorophenyl)-1-phenyl-2-(pyridine-2-carbonyl)-4-pyridin-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 122221340 |
| Molecular Formula | C27H19ClN2O3 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 3-(4-chlorophenyl)-1-phenyl-2-(pyridine-2-carbonyl)-4-pyridin-2-ylbutane-1,4-dione |
| SMILES | O=C(c1ccccc1)C(C(=O)c1ccccn1)C(C(=O)c1ccccn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H19ClN2O3/c28-20-14-12-18(13-15-20)23(26(32)21-10-4-6-16-29-21)24(25(31)19-8-2-1-3-9-19)27(33)22-11-5-7-17-30-22/h1-17,23-24H |
| InChIKey | NRKKSDXNMKWROV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|