C26H20Cl3NO3 — CID 122221427
(4R)-4-benzyl-2-phenyl-4-[(1S)-4,4,4-trichloro-3-oxo-1-phenylbutyl]-1,3-oxazol-5-one (PubChem CID 122221427) has the molecular formula C26H20Cl3NO3 and a molecular weight of 500.81 g/mol. Its IUPAC name is (4R)-4-benzyl-2-phenyl-4-[(1S)-4,4,4-trichloro-3-oxo-1-phenylbutyl]-1,3-oxazol-5-one.
| Compound Name | (4R)-4-benzyl-2-phenyl-4-[(1S)-4,4,4-trichloro-3-oxo-1-phenylbutyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 122221427 |
| Molecular Formula | C26H20Cl3NO3 |
| Molecular Weight | 500.81 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | (4R)-4-benzyl-2-phenyl-4-[(1S)-4,4,4-trichloro-3-oxo-1-phenylbutyl]-1,3-oxazol-5-one |
| SMILES | O=C(C[C@@H](c1ccccc1)[C@@]1(Cc2ccccc2)N=C(c2ccccc2)OC1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H20Cl3NO3/c27-26(28,29)22(31)16-21(19-12-6-2-7-13-19)25(17-18-10-4-1-5-11-18)24(32)33-23(30-25)20-14-8-3-9-15-20/h1-15,21H,16-17H2/t21-,25+/m0/s1 |
| InChIKey | FRXSAILDPLMWOO-SQJMNOBHSA-N |
| XLogP | 6.08 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.81 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|