C33H27NO3 — CID 102198571
(4S)-4-benzyl-4-[(E,1S)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one (PubChem CID 102198571) has the molecular formula C33H27NO3 and a molecular weight of 485.58 g/mol. Its IUPAC name is (4S)-4-benzyl-4-[(E,1S)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4S)-4-benzyl-4-[(E,1S)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 102198571 |
| Molecular Formula | C33H27NO3 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (4S)-4-benzyl-4-[(E,1S)-3-oxo-1,5-diphenylpent-4-enyl]-2-phenyl-1,3-oxazol-5-one |
| SMILES | O=C(/C=C/c1ccccc1)C[C@@H](c1ccccc1)[C@]1(Cc2ccccc2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C33H27NO3/c35-29(22-21-25-13-5-1-6-14-25)23-30(27-17-9-3-10-18-27)33(24-26-15-7-2-8-16-26)32(36)37-31(34-33)28-19-11-4-12-20-28/h1-22,30H,23-24H2/b22-21+/t30-,33-/m0/s1 |
| InChIKey | CFYFWGCQTCBSPG-IKCGGNPQSA-N |
| XLogP | 6.43 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|