C16H22NOP — CID 122222800
(7R)-7-(furan-2-yl)-2,3,4,5,6,8-hexamethyl-8-aza-1-phosphatricyclo[3.3.0.02,6]oct-3-ene (PubChem CID 122222800) has the molecular formula C16H22NOP and a molecular weight of 275.33 g/mol. Its IUPAC name is (7R)-7-(furan-2-yl)-2,3,4,5,6,8-hexamethyl-8-aza-1-phosphatricyclo[3.3.0.02,6]oct-3-ene.
| Compound Name | (7R)-7-(furan-2-yl)-2,3,4,5,6,8-hexamethyl-8-aza-1-phosphatricyclo[3.3.0.02,6]oct-3-ene |
|---|---|
| PubChem CID | 122222800 |
| Molecular Formula | C16H22NOP |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (7R)-7-(furan-2-yl)-2,3,4,5,6,8-hexamethyl-8-aza-1-phosphatricyclo[3.3.0.02,6]oct-3-ene |
| SMILES | CC1=C(C)C2(C)P3N(C)[C@@H](c4ccco4)C2(C)C13C |
| InChI | InChI=1S/C16H22NOP/c1-10-11(2)16(5)14(3)13(12-8-7-9-18-12)17(6)19(16)15(10,14)4/h7-9,13H,1-6H3/t13-,14?,15?,16?,19?/m0/s1 |
| InChIKey | RGMNHLWZIGCHNQ-IWUURBKTSA-N |
| XLogP | 4.55 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|